![[ICO]](/icons/blank.gif){kind=icon}
|
Name | Last modified | Size | Description |
|---|---|---|---|---|
|
Parent Directory | - | ||
|
2 Hero feat. Miku Hatsune | 20-Apr-2018 16:20 | - | |
|
A Magia dos Instrumentos | 20-Apr-2018 16:20 | - | |
|
A.T.C. | 20-Apr-2018 16:20 | - | |
|
APP | 20-Apr-2018 16:20 | - | |
|
Acid Love Bites | 20-Apr-2018 16:20 | - | |
|
Aides | 20-Apr-2018 16:20 | - | |
|
Ali Ekber Çiçek | 20-Apr-2018 16:20 | - | |
|
Alkotrio | 20-Apr-2018 16:20 | - | |
|
All Against All | 20-Apr-2018 16:20 | - | |
|
Alston | 20-Apr-2018 16:20 | - | |
|
American Static | 20-Apr-2018 16:20 | - | |
|
Andrew Young | 20-Apr-2018 16:20 | - | |
|
Andy Denton | 20-Apr-2018 16:20 | - | |
|
Anger Of The Darkness | 20-Apr-2018 16:20 | - | |
|
Atrox | 20-Apr-2018 16:20 | - | |
|
Audioporno | 20-Apr-2018 16:20 | - | |
|
Banooba | 20-Apr-2018 16:20 | - | |
|
Barka tone in bele plombe | 20-Apr-2018 16:20 | - | |
|
Beige | 20-Apr-2018 16:20 | - | |
|
Ben Broussard | 20-Apr-2018 16:20 | - | |
|
Ben Herman | 20-Apr-2018 16:20 | - | |
|
Bev Barnett & Greg Newlon | 20-Apr-2018 16:20 | - | |
|
Beyond Light | 20-Apr-2018 16:20 | - | |
|
Birdlips | 20-Apr-2018 16:20 | - | |
|
Black & White | 20-Apr-2018 16:20 | - | |
|
Bodie | 20-Apr-2018 16:20 | - | |
|
Brainsaw | 20-Apr-2018 16:20 | - | |
|
Broken Social Scene & J Mascis | 20-Apr-2018 16:20 | - | |
|
Bryce Grunden | 20-Apr-2018 16:20 | - | |
|
Cameron Dezen | 20-Apr-2018 16:20 | - | |
|
Carmen | 20-Apr-2018 16:20 | - | |
|
Catnip | 20-Apr-2018 16:20 | - | |
|
Cellar of Rats | 20-Apr-2018 16:20 | - | |
|
Changui | 20-Apr-2018 16:20 | - | |
|
Charlie Wolf | 20-Apr-2018 16:20 | - | |
|
Chichke & MultiTech | 20-Apr-2018 16:20 | - | |
|
Chieftans of Creep | 20-Apr-2018 16:20 | - | |
|
Chris Pandolfi | 20-Apr-2018 16:20 | - | |
|
Citadel | 20-Apr-2018 16:20 | - | |
|
Citizen Kane | 20-Apr-2018 16:20 | - | |
|
Clocks and Clouds | 20-Apr-2018 16:20 | - | |
|
Coen Oscar Polack | 20-Apr-2018 16:20 | - | |
|
Count & Sinden | 20-Apr-2018 16:20 | - | |
|
Covert | 20-Apr-2018 16:20 | - | |
|
Cripta | 20-Apr-2018 16:20 | - | |
|
Crisk. | 20-Apr-2018 16:20 | - | |
|
D Numbers | 20-Apr-2018 16:20 | - | |
|
D.M.C. Project | 20-Apr-2018 16:20 | - | |
|
Daniel Swain | 20-Apr-2018 16:20 | - | |
|
Darcy Perry | 20-Apr-2018 16:20 | - | |
|
Dave Buxton Trio | 20-Apr-2018 16:20 | - | |
|
David Fernández Rivera & Carlos Liger | 20-Apr-2018 16:20 | - | |
|
David Ruehl | 20-Apr-2018 16:20 | - | |
|
Derek Bailey & Simon H. Fell | 20-Apr-2018 16:20 | - | |
|
Desert Sons | 20-Apr-2018 16:20 | - | |
|
Diabolus Sanctus | 20-Apr-2018 16:20 | - | |
|
Dilba | 20-Apr-2018 16:20 | - | |
|
Dilip Reddy | 20-Apr-2018 16:20 | - | |
|
Dimebag Jonnys | 20-Apr-2018 16:20 | - | |
|
Dirk Bielefeldt | 20-Apr-2018 16:20 | - | |
|
Discobar Galaxie | 20-Apr-2018 16:20 | - | |
|
Divulgence | 20-Apr-2018 16:20 | - | |
|
Doom Engine | 20-Apr-2018 16:20 | - | |
|
Double P. | 20-Apr-2018 16:20 | - | |
|
Dr Angel Escudero | 20-Apr-2018 16:20 | - | |
|
Drown in Solitude | 20-Apr-2018 16:20 | - | |
|
Dsum | 20-Apr-2018 16:20 | - | |
|
Duck Fight Goose | 20-Apr-2018 16:20 | - | |
|
Duo Pantastic | 20-Apr-2018 16:20 | - | |
|
E.Naive | 20-Apr-2018 16:20 | - | |
|
Echtzeit | 20-Apr-2018 16:20 | - | |
|
Edmundas Kučinskas | 20-Apr-2018 16:20 | - | |
|
Escanaba Firing Line | 20-Apr-2018 16:20 | - | |
|
F-Systems | 20-Apr-2018 16:20 | - | |
|
Fall Victim | 20-Apr-2018 16:20 | - | |
|
Falling On A Leap Year | 20-Apr-2018 16:20 | - | |
|
Faramarz Assef | 20-Apr-2018 16:20 | - | |
|
Frank Connell | 20-Apr-2018 16:20 | - | |
|
Frank Heller's Fabulous Rhythm Weasels | 20-Apr-2018 16:20 | - | |
|
Freddie Cruger feat. Rapadon | 20-Apr-2018 16:20 | - | |
|
Février | 20-Apr-2018 16:20 | - | |
|
G-Zet | 20-Apr-2018 16:20 | - | |
|
G.E. Con-X-Ion | 20-Apr-2018 16:20 | - | |
|
Gala | 20-Apr-2018 16:20 | - | |
|
God's Groove | 20-Apr-2018 16:20 | - | |
|
GranG | 20-Apr-2018 16:20 | - | |
|
Greater Vision | 20-Apr-2018 16:20 | - | |
|
Gucci Mane feat. French Montana | 20-Apr-2018 16:20 | - | |
|
Halfcocked | 20-Apr-2018 16:20 | - | |
|
Heat-Ray | 20-Apr-2018 16:20 | - | |
|
Henn's Böhmische Talentschmiede | 20-Apr-2018 16:20 | - | |
|
Herman Steenkamp | 20-Apr-2018 16:20 | - | |
|
Hevikorolla | 20-Apr-2018 16:20 | - | |
|
Hickey | 20-Apr-2018 16:20 | - | |
|
Human Feel | 20-Apr-2018 16:20 | - | |
|
Hundows | 20-Apr-2018 16:20 | - | |
|
Immoral Fibres | 20-Apr-2018 16:20 | - | |
|
Infinitesimal | 20-Apr-2018 16:20 | - | |
|
Integrity | 20-Apr-2018 16:20 | - | |
|
Intruder | 20-Apr-2018 16:20 | - | |
|
Invisible Waves | 20-Apr-2018 16:20 | - | |
|
J Pelirrojo | 20-Apr-2018 16:20 | - | |
|
Jan Garbarek & Bobo Stenson & Terje Rypdal & Arild Andersen & Jon Christensen | 20-Apr-2018 16:20 | - | |
|
Jean-Louis Rassinfosse, Chet Baker & Philip Catherine | 20-Apr-2018 16:20 | - | |
|
Jeanie Lambe | 20-Apr-2018 16:20 | - | |
|
Jesse Lacey | 20-Apr-2018 16:20 | - | |
|
Jock Mitchell | 20-Apr-2018 16:20 | - | |
|
John Paul Jones | 20-Apr-2018 16:20 | - | |
|
Jon and The Nightriders | 20-Apr-2018 16:20 | - | |
|
Jonathan Firstenberg & Ed Dzubak | 20-Apr-2018 16:20 | - | |
|
Joubert de Carvalho | 20-Apr-2018 16:20 | - | |
|
Juke FX | 20-Apr-2018 16:20 | - | |
|
Just Off Turner | 20-Apr-2018 16:20 | - | |
|
Kachafayah Sound | 20-Apr-2018 16:20 | - | |
|
Kako | 20-Apr-2018 16:20 | - | |
|
Kamaedzitca | 20-Apr-2018 16:20 | - | |
|
Kauterion | 20-Apr-2018 16:20 | - | |
|
Kicker | 20-Apr-2018 16:20 | - | |
|
L'impero delle ombre | 20-Apr-2018 16:20 | - | |
|
L'uomo di gomma | 20-Apr-2018 16:20 | - | |
|
Lenny Savage | 20-Apr-2018 16:20 | - | |
|
Liars Academy | 20-Apr-2018 16:20 | - | |
|
Lil Irocc Williams | 20-Apr-2018 16:20 | - | |
|
Los Coquillos | 20-Apr-2018 16:20 | - | |
|
Los Nadiens | 20-Apr-2018 16:20 | - | |
|
Los Pasajeros | 20-Apr-2018 16:20 | - | |
|
Louis Sclavis Atlas Trio | 20-Apr-2018 16:20 | - | |
|
LoveSeat Daredevil | 20-Apr-2018 16:20 | - | |
|
Mad Gay Mafia | 20-Apr-2018 16:20 | - | |
|
MadLove | 20-Apr-2018 16:20 | - | |
|
Marco Paulo | 20-Apr-2018 16:20 | - | |
|
Marie Bellet | 20-Apr-2018 16:20 | - | |
|
Marlène Dorcéna | 20-Apr-2018 16:20 | - | |
|
Miloopa | 20-Apr-2018 16:20 | - | |
|
Miss Halliwell | 20-Apr-2018 16:20 | - | |
|
Mix Master Spade & Compton Posse | 20-Apr-2018 16:20 | - | |
|
Mixed Bizness | 20-Apr-2018 16:20 | - | |
|
Mohammad Musavi | 20-Apr-2018 16:20 | - | |
|
Monster in the Machine | 20-Apr-2018 16:20 | - | |
|
Morella's Forest | 20-Apr-2018 16:20 | - | |
|
Mystery Palace | 20-Apr-2018 16:20 | - | |
|
Naiara | 20-Apr-2018 16:20 | - | |
|
Naked | 20-Apr-2018 16:20 | - | |
|
Native Nuttz | 20-Apr-2018 16:20 | - | |
|
New Socks | 20-Apr-2018 16:20 | - | |
|
Nita | 20-Apr-2018 16:20 | - | |
|
Noah Stewart | 20-Apr-2018 16:20 | - | |
|
Noxious | 20-Apr-2018 16:20 | - | |
|
Old Skool Orchestra | 20-Apr-2018 16:20 | - | |
|
Orquesta Sinfónica de Xalapa & Tlen Huicani | 20-Apr-2018 16:20 | - | |
|
Ortiga | 20-Apr-2018 16:20 | - | |
|
Osiris Rising | 20-Apr-2018 16:20 | - | |
|
Pachanga Boys | 20-Apr-2018 16:20 | - | |
|
Pachuly & Friends | 20-Apr-2018 16:20 | - | |
|
Pankraz | 20-Apr-2018 16:20 | - | |
|
Pat H | 20-Apr-2018 16:20 | - | |
|
Per O Noss | 20-Apr-2018 16:20 | - | |
|
Phallus | 20-Apr-2018 16:20 | - | |
|
Phyx | 20-Apr-2018 16:20 | - | |
|
Pit Malone | 20-Apr-2018 16:20 | - | |
|
Premium Standard | 20-Apr-2018 16:20 | - | |
|
Professor Kenneth P. Vickery | 20-Apr-2018 16:20 | - | |
|
Project Phoenix | 20-Apr-2018 16:20 | - | |
|
Proton Kinoun | 20-Apr-2018 16:20 | - | |
|
Psalmen voor Nu | 20-Apr-2018 16:20 | - | |
|
RRSO Symphony Orchestra | 20-Apr-2018 16:20 | - | |
|
Raflesia | 20-Apr-2018 16:20 | - | |
|
Real 4 | 20-Apr-2018 16:20 | - | |
|
Rumblejetts | 20-Apr-2018 16:20 | - | |
|
Ryan Holladay | 20-Apr-2018 16:20 | - | |
|
San b | 20-Apr-2018 16:20 | - | |
|
Sascha Krohn | 20-Apr-2018 16:20 | - | |
|
Satanic War Machine | 20-Apr-2018 16:20 | - | |
|
Schwefel | 20-Apr-2018 16:20 | - | |
|
Score Set at Zero | 20-Apr-2018 16:20 | - | |
|
Shadows Decay | 20-Apr-2018 16:20 | - | |
|
Shivaz | 20-Apr-2018 16:20 | - | |
|
Singing Melody | 20-Apr-2018 16:20 | - | |
|
Skatroniks Jamaica | 20-Apr-2018 16:20 | - | |
|
Slide 50 | 20-Apr-2018 16:20 | - | |
|
Soul Electrik | 20-Apr-2018 16:20 | - | |
|
Splinterfaction | 20-Apr-2018 16:20 | - | |
|
Stephen Walking & Ephixa | 20-Apr-2018 16:20 | - | |
|
Strip | 20-Apr-2018 16:20 | - | |
|
Stéphane Grappelli & Baden Powell | 20-Apr-2018 16:20 | - | |
|
Superglue Revenge | 20-Apr-2018 16:20 | - | |
|
Svend Asmussen Quartet | 20-Apr-2018 16:20 | - | |
|
Syahmi Rawi | 20-Apr-2018 16:20 | - | |
|
Széki Kurva | 20-Apr-2018 16:20 | - | |
|
Teresa Catalán | 20-Apr-2018 16:20 | - | |
|
Terry Leblanc | 20-Apr-2018 16:20 | - | |
|
The Brain - Central Nervous System | 20-Apr-2018 16:20 | - | |
|
The British Expeditionary Force | 20-Apr-2018 16:20 | - | |
|
The Bustamante Players | 20-Apr-2018 16:20 | - | |
|
The Candy Darlings | 20-Apr-2018 16:20 | - | |
|
The Candy-Cat-Whore | 20-Apr-2018 16:20 | - | |
|
The Daniel Indart Project | 20-Apr-2018 16:20 | - | |
|
The Droyds | 20-Apr-2018 16:20 | - | |
|
The Ex-Men | 20-Apr-2018 16:20 | - | |
|
The Foundling Wheel | 20-Apr-2018 16:20 | - | |
|
The Franklin-Neumann Project | 20-Apr-2018 16:20 | - | |
|
The If People Were Paper | 20-Apr-2018 16:20 | - | |
|
The KinG | 20-Apr-2018 16:20 | - | |
|
The Legendary Raw Deal | 20-Apr-2018 16:20 | - | |
|
The Mes | 20-Apr-2018 16:20 | - | |
|
The More Assured | 20-Apr-2018 16:20 | - | |
|
The Pounders | 20-Apr-2018 16:20 | - | |
|
The Prisondream | 20-Apr-2018 16:20 | - | |
|
The Pulpit | 20-Apr-2018 16:20 | - | |
|
The Rattlers | 20-Apr-2018 16:20 | - | |
|
The Sabre Rattlers | 20-Apr-2018 16:20 | - | |
|
The Shut-Ups | 20-Apr-2018 16:20 | - | |
|
The Sines | 20-Apr-2018 16:20 | - | |
|
The Slate Pipe Banjo Draggers | 20-Apr-2018 16:20 | - | |
|
The Swan Bride | 20-Apr-2018 16:20 | - | |
|
The Underneath | 20-Apr-2018 16:20 | - | |
|
The Young Offenders | 20-Apr-2018 16:20 | - | |
|
Throw Stephanie in the Incinerator | 20-Apr-2018 16:20 | - | |
|
Tom Wuest | 20-Apr-2018 16:20 | - | |
|
Trailer Hitch | 20-Apr-2018 16:20 | - | |
|
Trevor Loveys | 20-Apr-2018 16:20 | - | |
|
Tummel | 20-Apr-2018 16:20 | - | |
|
Tumsa | 20-Apr-2018 16:20 | - | |
|
Underkarl | 20-Apr-2018 16:20 | - | |
|
Unheilig & Project Pitchfork | 20-Apr-2018 16:20 | - | |
|
Vamsi Das | 20-Apr-2018 16:20 | - | |
|
Vandoorn | 20-Apr-2018 16:20 | - | |
|
Viking Galaxy | 20-Apr-2018 16:20 | - | |
|
Viridian Sun | 20-Apr-2018 16:20 | - | |
|
Vivid Atmosphere | 20-Apr-2018 16:20 | - | |
|
Walknut | 20-Apr-2018 16:20 | - | |
|
Whiteshoulders | 20-Apr-2018 16:20 | - | |
|
William Schotte | 20-Apr-2018 16:20 | - | |
|
X-Factor All Star | 20-Apr-2018 16:20 | - | |
|
Zisa | 20-Apr-2018 16:20 | - | |
|
За деньги | 20-Apr-2018 16:20 | - | |
|
Лидия Кавина | 20-Apr-2018 16:20 | - | |
|
Олег Горшков | 20-Apr-2018 16:20 | - | |
|
دنگ شو | 20-Apr-2018 16:20 | - | |
|
ぷちぷりーず | 20-Apr-2018 16:20 | - | |
|
ハンサム兄弟 | 20-Apr-2018 16:20 | - | |
|
人生 (ZIN-SAY!) | 20-Apr-2018 16:20 | - | |
|
壊れた王 | 20-Apr-2018 16:20 | - | |
|
牧岡奈美 | 20-Apr-2018 16:20 | - | |
|
百怪ノ行列 | 20-Apr-2018 16:20 | - | |
|
紅-EVE- | 20-Apr-2018 16:20 | - | |
|
荘野ジュリ | 20-Apr-2018 16:20 | - | |
|
谷山紀章 | 20-Apr-2018 16:20 | - | |
|
강균성 | 20-Apr-2018 16:20 | - | |
|
ＧＲＥＧＯＲＹ | 20-Apr-2018 16:20 | - | |